Available from stock
Categories: Fluorescent Detection, Fluorescent Detection
Fluorogenic substrate for caprylate esterase used as tool to identify salmonella in clinical labs. MUCAP consists of a flexible eight carbon atom ester conjugated with 4-methylumbelliferone. The non-fluorescent MUCAP substrate interacts with the salmonella C8 esterase in a specific manner leading to the release of highly fluorescent 4-methylumbelliferone that emitts strongly at 485 nm (blue fluorescence) (ex = 366 nm).
| Synonyms | 4-Methylumbelliferyl caprylate, MUCAP, 4-Methyl-2-oxo-2H-chromen-7-yl octanoate |
|---|---|
| Purity | mind.98% (HPLC) |
| Appearance | White to off-white powder |
| CAS-Number | 20671-66-3 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.36 |
| Identity | 1H-NMR |
| Solvents | ethyl acetate (~50 mg/ml), methanol, water, acetone (>10 mg/ml) |
| Melting Point | 45 °C |
| Boiling Point | 441.1 °C at 760 mmHg (Predicted) |
| Refractive Index | n20D 1.53 (Predicted) |
| Density | 1.11 g/cm3 (Predicted) |
| Smiles | CC(C1=CC=C(OC(CCCCCCC)=O)C=C1O2)=CC2=O |
| InChi Key | WZEWYQWWSCVHCP-UHFFFAOYSA-N |
| Shipping | AMBIENT |
| Short Term Storage | RT |
| Long Term Storage | +4°C |
| Handling Advice | Protect from light and moisture. |
| Use / Stability | Stable for at least 2 years after receipt when stored at +4°C. |
| Hazard statements | H335, H319 |
| Precautionary statements | P233, P260, P261, P264, P271, P280, P302 + P352, P304 + P340, P305 + P351 + P338, P312, P321, P332 + P313, P337 + P313, P340, P362, P403, P405, P501 |
| GHS Symbol | GHS07 |
| Transportation | Not dangerous goods |
| References | (1) M. Olsson, et al., J. Clin. Microbiol. 1991, 2631 (1991), (2) A.S. Al-Kady, et al., Spectroch. Acta Part A 79, 1540 (2011) |
| InChi | InChI=1S/C18H22O4/c1-3-4-5-6-7-8-17(19)21-14-9-10-15-13(2)11-18(20)22-16(15)12-14/h9-12H,3-8H2,1-2H3 |
| Quantity | 5 g, 25 g, Bulk |
Meptyldinocap
