Available from stock
Category: Building Blocks, Intermediates, Reagents
Amine used as chiral and organic building block.
| Synonyms | (S)-2,3-Dihydro-1H-inden-1-amine |
|---|---|
| Purity | ≥98% (HPLC) |
| Appearance | Colorless to yellow liquid |
| CAS-Number | 61341-86-4 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 |
| Identity | 1H-NMR |
| Solvents | toluene, DMSO, chloroform |
| Boiling Point | 96-97 °C (8 mmHg) |
| Optical Activity | [α]20/D +17.0±1.5°, c = 1.5% in methanol |
| Refractive Index | n20/D 1.562 |
| Density | 1.038 g/ml at 25 °C |
| Smiles | N[C@H]1CCC2=C1C=CC=C2 |
| InChi Key | XJEVHMGJSYVQBQ-VIFPVBQESA-N |
| Shipping | AMBIENT |
| Short Term Storage | +4°C |
| Long Term Storage | +4°C |
| Handling Advice | Protect from light and moisture. |
| Use / Stability | Stable for at least 2 years after receipt when stored at +4°C. |
| Hazard statements | H315, H319, H335 |
| Precautionary statements | P261, P305 + P351 + P338 |
| GHS Symbol | GHS07 |
| Signal word | Warning |
| Transportation | Not dangerous goods |
| InChi | InChI=1S/C9H11N/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6,10H2/t9-/m0/s1 |
| Quantity | 250 mg, 5 g, 25 g, Bulk |
Alcian Blue 8GX solution 
