Available from stock
Category: API's & Intermediates
For Research Use Only. Not Intended for Diagnostic or Therapeutic Use.
Stimulant slightly ionotropic drug of the xanthine chemical class, with physiological effects similar to caffeine. It is combined with pharmaceutical drugs to form stable salts.
| Synonyms | NSC 6113, 8-Chloro-1,3-dimethyl-2,6(1H,3H)-purinedione |
|---|---|
| Purity | ≥99% (HPLC) |
| Appearance | White to off-white solid |
| CAS-Number | 85-18-7 |
| Molecular Formula | C7H7ClN4O2 |
| Molecular Weight | 214.61 |
| Identity | 1H-NMR |
| Solvents | sodium hydroxide, DMSO or methanol, water (0.3 g/l) |
| Boiling Point | 455° C |
| Density | 1.591 g/cm3 |
| Smiles | O=C(N1C)C2=C(NC(Cl)=N2)N(C)C1=O |
| InChi Key | RYIGNEOBDRVTHA-UHFFFAOYSA-N |
| Shipping | AMBIENT |
| Short Term Storage | RT |
| Long Term Storage | RT |
| Handling Advice | Protect from light and moisture. |
| Use / Stability | Stable for at least 2 years after receipt when stored at RT. |
| Hazard statements | H302 |
| Precautionary statements | P264 + P270 |
| GHS Symbol | GHS07 |
| Signal word | Warning |
| Transportation | Not dangerous goods |
| References | (1) S.H. Snyder, et al.: PNAS 78, 3260 (1981) |
| InChi | InChI=1S/C7H7ClN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10) |
| Quantity | 100 g, 1 kg, Bulk |
(+)-Carvone
